C17H21Cl2N3OS — CID 11921146
2-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]carbamothioyl-methylamino]-N-(2,6-dichlorophenyl)acetamide (PubChem CID 11921146) has the molecular formula C17H21Cl2N3OS and a molecular weight of 386.35 g/mol. Its IUPAC name is 2-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]carbamothioyl-methylamino]-N-(2,6-dichlorophenyl)acetamide.
| Compound Name | 2-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]carbamothioyl-methylamino]-N-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 11921146 |
| Molecular Formula | C17H21Cl2N3OS |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 2-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]carbamothioyl-methylamino]-N-(2,6-dichlorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1c(Cl)cccc1Cl)C(=S)N[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C17H21Cl2N3OS/c1-22(17(24)20-14-8-10-5-6-11(14)7-10)9-15(23)21-16-12(18)3-2-4-13(16)19/h2-4,10-11,14H,5-9H2,1H3,(H,20,24)(H,21,23)/t10-,11+,14+/m0/s1 |
| InChIKey | AFBVUYYVLLQLQW-MISXGVKJSA-N |
| XLogP | 3.93 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|