C15H17N3O6S — CID 119218140
2-[1-[[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]amino]cyclobutyl]acetic acid (PubChem CID 119218140) has the molecular formula C15H17N3O6S and a molecular weight of 367.38 g/mol. Its IUPAC name is 2-[1-[[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 119218140 |
| Molecular Formula | C15H17N3O6S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2-[1-[[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]amino]cyclobutyl]acetic acid |
| SMILES | NC(=O)c1ccc(SCC(=O)NC2(CC(=O)O)CCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17N3O6S/c16-14(22)9-2-3-11(10(6-9)18(23)24)25-8-12(19)17-15(4-1-5-15)7-13(20)21/h2-3,6H,1,4-5,7-8H2,(H2,16,22)(H,17,19)(H,20,21) |
| InChIKey | IEPLWEREGPICCC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|