C16H26NO2+ — CID 11921908
(3R,4S)-1-[2-(2-methoxyphenoxy)ethyl]-3,4-dimethylpiperidin-1-ium (PubChem CID 11921908) has the molecular formula C16H26NO2+ and a molecular weight of 264.39 g/mol. Its IUPAC name is (3R,4S)-1-[2-(2-methoxyphenoxy)ethyl]-3,4-dimethylpiperidin-1-ium.
| Compound Name | (3R,4S)-1-[2-(2-methoxyphenoxy)ethyl]-3,4-dimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 11921908 |
| Molecular Formula | C16H26NO2+ |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | (3R,4S)-1-[2-(2-methoxyphenoxy)ethyl]-3,4-dimethylpiperidin-1-ium |
| SMILES | COc1ccccc1OCC[NH+]1CC[C@H](C)[C@@H](C)C1 |
| InChI | InChI=1S/C16H25NO2/c1-13-8-9-17(12-14(13)2)10-11-19-16-7-5-4-6-15(16)18-3/h4-7,13-14H,8-12H2,1-3H3/p+1/t13-,14-/m0/s1 |
| InChIKey | QTEPPUOVUCXBTM-KBPBESRZSA-O |
| XLogP | 1.63 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |