C19H28ClN3O4 — CID 119227411
7-[[5-(tert-butylcarbamoylamino)-2-chlorobenzoyl]amino]heptanoic acid (PubChem CID 119227411) has the molecular formula C19H28ClN3O4 and a molecular weight of 397.90 g/mol. Its IUPAC name is 7-[[5-(tert-butylcarbamoylamino)-2-chlorobenzoyl]amino]heptanoic acid.
| Compound Name | 7-[[5-(tert-butylcarbamoylamino)-2-chlorobenzoyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 119227411 |
| Molecular Formula | C19H28ClN3O4 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 7-[[5-(tert-butylcarbamoylamino)-2-chlorobenzoyl]amino]heptanoic acid |
| SMILES | CC(C)(C)NC(=O)Nc1ccc(Cl)c(C(=O)NCCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C19H28ClN3O4/c1-19(2,3)23-18(27)22-13-9-10-15(20)14(12-13)17(26)21-11-7-5-4-6-8-16(24)25/h9-10,12H,4-8,11H2,1-3H3,(H,21,26)(H,24,25)(H2,22,23,27) |
| InChIKey | UABIANZNEKVMEK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|