C16H22ClN3O4 — CID 19996441
3-[[5-(6-aminohexanoylamino)-2-chlorobenzoyl]amino]propanoic acid (PubChem CID 19996441) has the molecular formula C16H22ClN3O4 and a molecular weight of 355.82 g/mol. Its IUPAC name is 3-[[5-(6-aminohexanoylamino)-2-chlorobenzoyl]amino]propanoic acid.
| Compound Name | 3-[[5-(6-aminohexanoylamino)-2-chlorobenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19996441 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3-[[5-(6-aminohexanoylamino)-2-chlorobenzoyl]amino]propanoic acid |
| SMILES | NCCCCCC(=O)Nc1ccc(Cl)c(C(=O)NCCC(=O)O)c1 |
| InChI | InChI=1S/C16H22ClN3O4/c17-13-6-5-11(20-14(21)4-2-1-3-8-18)10-12(13)16(24)19-9-7-15(22)23/h5-6,10H,1-4,7-9,18H2,(H,19,24)(H,20,21)(H,22,23) |
| InChIKey | SKXKDGRLMABZEB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|