C12H13NO4S2 — CID 11923600
(3aS,6aS)-3-(4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-one (PubChem CID 11923600) has the molecular formula C12H13NO4S2 and a molecular weight of 299.37 g/mol. Its IUPAC name is (3aS,6aS)-3-(4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-one.
| Compound Name | (3aS,6aS)-3-(4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-one |
|---|---|
| PubChem CID | 11923600 |
| Molecular Formula | C12H13NO4S2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | (3aS,6aS)-3-(4-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-one |
| SMILES | COc1ccc(N2C(=O)S[C@@H]3CS(=O)(=O)C[C@@H]32)cc1 |
| InChI | InChI=1S/C12H13NO4S2/c1-17-9-4-2-8(3-5-9)13-10-6-19(15,16)7-11(10)18-12(13)14/h2-5,10-11H,6-7H2,1H3/t10-,11+/m0/s1 |
| InChIKey | UVCDNOHEEXJZGA-WDEREUQCSA-N |
| XLogP | 1.53 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|