C17H18N2O7 — CID 11923765
[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-[(1R,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate (PubChem CID 11923765) has the molecular formula C17H18N2O7 and a molecular weight of 362.34 g/mol. Its IUPAC name is [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-[(1R,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate.
| Compound Name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-[(1R,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 11923765 |
| Molecular Formula | C17H18N2O7 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | [5-(furan-2-yl)-1,2-oxazol-3-yl]methyl 2-[(1R,2R,3R)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
| SMILES | C[C@@H]1CC(=O)[C@H](CC(=O)OCc2cc(-c3ccco3)on2)[C@@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O7/c1-10-5-14(20)12(13(10)8-19(22)23)7-17(21)25-9-11-6-16(26-18-11)15-3-2-4-24-15/h2-4,6,10,12-13H,5,7-9H2,1H3/t10-,12-,13-/m1/s1 |
| InChIKey | AUMMCYYEHLUUOT-RAIGVLPGSA-N |
| XLogP | 2.49 |
| TPSA | 125.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|