C18H20ClNO7 — CID 11915335
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate (PubChem CID 11915335) has the molecular formula C18H20ClNO7 and a molecular weight of 397.81 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 11915335 |
| Molecular Formula | C18H20ClNO7 |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetate |
| SMILES | C[C@H]1CC(=O)[C@@H](CC(=O)OCc2cc(Cl)cc3c2OCOC3)[C@@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C18H20ClNO7/c1-10-2-16(21)14(15(10)6-20(23)24)5-17(22)26-8-12-4-13(19)3-11-7-25-9-27-18(11)12/h3-4,10,14-15H,2,5-9H2,1H3/t10-,14-,15+/m0/s1 |
| InChIKey | LWJKJWLYLKJRGX-NZVBXONLSA-N |
| XLogP | 2.76 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|