C14H14Cl2N2O5S — CID 11925800
(5R)-5-(2,4-dichlorophenyl)-3-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-methylimidazolidine-2,4-dione (PubChem CID 11925800) has the molecular formula C14H14Cl2N2O5S and a molecular weight of 393.25 g/mol. Its IUPAC name is (5R)-5-(2,4-dichlorophenyl)-3-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2,4-dichlorophenyl)-3-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11925800 |
| Molecular Formula | C14H14Cl2N2O5S |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | (5R)-5-(2,4-dichlorophenyl)-3-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccc(Cl)cc2Cl)NC(=O)N([C@H]2CS(=O)(=O)C[C@@H]2O)C1=O |
| InChI | InChI=1S/C14H14Cl2N2O5S/c1-14(8-3-2-7(15)4-9(8)16)12(20)18(13(21)17-14)10-5-24(22,23)6-11(10)19/h2-4,10-11,19H,5-6H2,1H3,(H,17,21)/t10-,11-,14+/m0/s1 |
| InChIKey | DFIIVKFQWVDDIF-COPLHBTASA-N |
| XLogP | 0.92 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|