C17H24FN3O2S — CID 119282076
(2S)-2-amino-1-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]-4-methylsulfanylbutan-1-one (PubChem CID 119282076) has the molecular formula C17H24FN3O2S and a molecular weight of 353.46 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]-4-methylsulfanylbutan-1-one.
| Compound Name | (2S)-2-amino-1-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]-4-methylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 119282076 |
| Molecular Formula | C17H24FN3O2S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (2S)-2-amino-1-[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]-4-methylsulfanylbutan-1-one |
| SMILES | CSCC[C@H](N)C(=O)N1CCN(C(=O)c2ccc(C)c(F)c2)CC1 |
| InChI | InChI=1S/C17H24FN3O2S/c1-12-3-4-13(11-14(12)18)16(22)20-6-8-21(9-7-20)17(23)15(19)5-10-24-2/h3-4,11,15H,5-10,19H2,1-2H3/t15-/m0/s1 |
| InChIKey | PZCGEZXARNFYBI-HNNXBMFYSA-N |
| XLogP | 1.50 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |