C19H27ClF2N2O3 — CID 119285270
N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119285270) has the molecular formula C19H27ClF2N2O3 and a molecular weight of 404.89 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119285270 |
| Molecular Formula | C19H27ClF2N2O3 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | CCOc1cc(CNC(=O)C2CC3CCCCC3N2)ccc1OC(F)F.Cl |
| InChI | InChI=1S/C19H26F2N2O3.ClH/c1-2-25-17-9-12(7-8-16(17)26-19(20)21)11-22-18(24)15-10-13-5-3-4-6-14(13)23-15;/h7-9,13-15,19,23H,2-6,10-11H2,1H3,(H,22,24);1H |
| InChIKey | YXAAGSXKFGRBJT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |