C19H30ClN3O4S — CID 119296309
N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119296309) has the molecular formula C19H30ClN3O4S and a molecular weight of 431.99 g/mol. Its IUPAC name is N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119296309 |
| Molecular Formula | C19H30ClN3O4S |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | COCCNS(=O)(=O)c1ccc(CNC(=O)C2CC3CCCCC3N2)cc1.Cl |
| InChI | InChI=1S/C19H29N3O4S.ClH/c1-26-11-10-21-27(24,25)16-8-6-14(7-9-16)13-20-19(23)18-12-15-4-2-3-5-17(15)22-18;/h6-9,15,17-18,21-22H,2-5,10-13H2,1H3,(H,20,23);1H |
| InChIKey | JSOVYYOQBRBLRD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|