C17H22ClFN2O — CID 119310101
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(6-fluoro-2,3-dihydroindol-1-yl)methanone;hydrochloride (PubChem CID 119310101) has the molecular formula C17H22ClFN2O and a molecular weight of 324.83 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(6-fluoro-2,3-dihydroindol-1-yl)methanone;hydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(6-fluoro-2,3-dihydroindol-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119310101 |
| Molecular Formula | C17H22ClFN2O |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(6-fluoro-2,3-dihydroindol-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(C1CC2CCCCC2N1)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C17H21FN2O.ClH/c18-13-6-5-11-7-8-20(16(11)10-13)17(21)15-9-12-3-1-2-4-14(12)19-15;/h5-6,10,12,14-15,19H,1-4,7-9H2;1H |
| InChIKey | CTHQVYGXVBAWDS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |