C20H29ClN4O2 — CID 119333739
6-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)-N-ethyl-2,3-dihydroindole-1-carboxamide;hydrochloride (PubChem CID 119333739) has the molecular formula C20H29ClN4O2 and a molecular weight of 392.93 g/mol. Its IUPAC name is 6-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)-N-ethyl-2,3-dihydroindole-1-carboxamide;hydrochloride.
| Compound Name | 6-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)-N-ethyl-2,3-dihydroindole-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119333739 |
| Molecular Formula | C20H29ClN4O2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 6-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonylamino)-N-ethyl-2,3-dihydroindole-1-carboxamide;hydrochloride |
| SMILES | CCNC(=O)N1CCc2ccc(NC(=O)C3CC4CCCCC4N3)cc21.Cl |
| InChI | InChI=1S/C20H28N4O2.ClH/c1-2-21-20(26)24-10-9-13-7-8-15(12-18(13)24)22-19(25)17-11-14-5-3-4-6-16(14)23-17;/h7-8,12,14,16-17,23H,2-6,9-11H2,1H3,(H,21,26)(H,22,25);1H |
| InChIKey | ZKVAYIMYZASMJE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |