C12H17F2N3O3S — CID 119332348
2-amino-N-[5-(tert-butylsulfamoyl)-2,4-difluorophenyl]acetamide (PubChem CID 119332348) has the molecular formula C12H17F2N3O3S and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-amino-N-[5-(tert-butylsulfamoyl)-2,4-difluorophenyl]acetamide.
| Compound Name | 2-amino-N-[5-(tert-butylsulfamoyl)-2,4-difluorophenyl]acetamide |
|---|---|
| PubChem CID | 119332348 |
| Molecular Formula | C12H17F2N3O3S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-amino-N-[5-(tert-butylsulfamoyl)-2,4-difluorophenyl]acetamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cc(NC(=O)CN)c(F)cc1F |
| InChI | InChI=1S/C12H17F2N3O3S/c1-12(2,3)17-21(19,20)10-5-9(16-11(18)6-15)7(13)4-8(10)14/h4-5,17H,6,15H2,1-3H3,(H,16,18) |
| InChIKey | NIUANKDWRFSUQU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |