C17H28ClN5O3 — CID 119333438
N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119333438) has the molecular formula C17H28ClN5O3 and a molecular weight of 385.90 g/mol. Its IUPAC name is N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119333438 |
| Molecular Formula | C17H28ClN5O3 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[1-[2-(2-methoxyethylamino)-2-oxoethyl]pyrazol-4-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | COCCNC(=O)Cn1cc(NC(=O)C2CC3CCCCC3N2)cn1.Cl |
| InChI | InChI=1S/C17H27N5O3.ClH/c1-25-7-6-18-16(23)11-22-10-13(9-19-22)20-17(24)15-8-12-4-2-3-5-14(12)21-15;/h9-10,12,14-15,21H,2-8,11H2,1H3,(H,18,23)(H,20,24);1H |
| InChIKey | MJQJVJMVQSDLHH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|