C18H20FNO3S — CID 119352190
6-[[4-(4-fluorophenyl)-5-methylthiophene-2-carbonyl]amino]hexanoic acid (PubChem CID 119352190) has the molecular formula C18H20FNO3S and a molecular weight of 349.43 g/mol. Its IUPAC name is 6-[[4-(4-fluorophenyl)-5-methylthiophene-2-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[4-(4-fluorophenyl)-5-methylthiophene-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119352190 |
| Molecular Formula | C18H20FNO3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 6-[[4-(4-fluorophenyl)-5-methylthiophene-2-carbonyl]amino]hexanoic acid |
| SMILES | Cc1sc(C(=O)NCCCCCC(=O)O)cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FNO3S/c1-12-15(13-6-8-14(19)9-7-13)11-16(24-12)18(23)20-10-4-2-3-5-17(21)22/h6-9,11H,2-5,10H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | MEBMMQBKXIWITC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|