C16H23N3O4 — CID 119357214
4-methyl-4-[[2-[(3-methylphenyl)carbamoylamino]acetyl]amino]pentanoic acid (PubChem CID 119357214) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-methyl-4-[[2-[(3-methylphenyl)carbamoylamino]acetyl]amino]pentanoic acid.
| Compound Name | 4-methyl-4-[[2-[(3-methylphenyl)carbamoylamino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119357214 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-methyl-4-[[2-[(3-methylphenyl)carbamoylamino]acetyl]amino]pentanoic acid |
| SMILES | Cc1cccc(NC(=O)NCC(=O)NC(C)(C)CCC(=O)O)c1 |
| InChI | InChI=1S/C16H23N3O4/c1-11-5-4-6-12(9-11)18-15(23)17-10-13(20)19-16(2,3)8-7-14(21)22/h4-6,9H,7-8,10H2,1-3H3,(H,19,20)(H,21,22)(H2,17,18,23) |
| InChIKey | KWQUWXPPSXINJC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |