C20H35N5OS — CID 11936484
1-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-3-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]amino]thiourea (PubChem CID 11936484) has the molecular formula C20H35N5OS and a molecular weight of 393.60 g/mol. Its IUPAC name is 1-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-3-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]amino]thiourea.
| Compound Name | 1-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-3-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 11936484 |
| Molecular Formula | C20H35N5OS |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 1-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-3-[[2-[3,5-dimethyl-1-(2-methylpropyl)pyrazol-4-yl]acetyl]amino]thiourea |
| SMILES | Cc1nn(CC(C)C)c(C)c1CC(=O)NNC(=S)N[C@H]1CCC[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C20H35N5OS/c1-12(2)11-25-16(6)17(15(5)24-25)10-19(26)22-23-20(27)21-18-9-7-8-13(3)14(18)4/h12-14,18H,7-11H2,1-6H3,(H,22,26)(H2,21,23,27)/t13-,14+,18+/m1/s1 |
| InChIKey | ZGQGVICUCPQPQU-GLJUWKHASA-N |
| XLogP | 3.02 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|