C15H24BrN5OS — CID 51423944
1-[(4-bromo-1,5-dimethylpyrazole-3-carbonyl)amino]-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 51423944) has the molecular formula C15H24BrN5OS and a molecular weight of 402.36 g/mol. Its IUPAC name is 1-[(4-bromo-1,5-dimethylpyrazole-3-carbonyl)amino]-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[(4-bromo-1,5-dimethylpyrazole-3-carbonyl)amino]-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 51423944 |
| Molecular Formula | C15H24BrN5OS |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 1-[(4-bromo-1,5-dimethylpyrazole-3-carbonyl)amino]-3-[(1R,2S,3S)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | Cc1c(Br)c(C(=O)NNC(=S)N[C@@H]2CCC[C@H](C)[C@@H]2C)nn1C |
| InChI | InChI=1S/C15H24BrN5OS/c1-8-6-5-7-11(9(8)2)17-15(23)19-18-14(22)13-12(16)10(3)21(4)20-13/h8-9,11H,5-7H2,1-4H3,(H,18,22)(H2,17,19,23)/t8-,9-,11+/m0/s1 |
| InChIKey | UMLOQIIXEDLSHJ-ATZCPNFKSA-N |
| XLogP | 2.42 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|