C20H28N4O4S — CID 11937385
1-[[2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetyl]amino]-3-[(1S,2R,3S)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 11937385) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is 1-[[2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetyl]amino]-3-[(1S,2R,3S)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[[2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetyl]amino]-3-[(1S,2R,3S)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 11937385 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-[[2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetyl]amino]-3-[(1S,2R,3S)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | C/C(=N/OCC(=O)NNC(=S)N[C@H]1CCC[C@H](C)[C@H]1C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H28N4O4S/c1-12-5-4-6-16(13(12)2)21-20(29)23-22-19(25)10-28-24-14(3)15-7-8-17-18(9-15)27-11-26-17/h7-9,12-13,16H,4-6,10-11H2,1-3H3,(H,22,25)(H2,21,23,29)/b24-14-/t12-,13+,16-/m0/s1 |
| InChIKey | JXVUWQLFLYGSTF-UITVJQMZSA-N |
| XLogP | 2.48 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|