C19H23N3O5S — CID 11937601
(E)-1-[(2S)-2-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]-3-(4-propoxyphenyl)prop-2-en-1-one (PubChem CID 11937601) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is (E)-1-[(2S)-2-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]-3-(4-propoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(2S)-2-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]-3-(4-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 11937601 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (E)-1-[(2S)-2-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]-3-(4-propoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1ccc(/C=C/C(=O)N2CCC[C@H]2c2nnc(S(C)(=O)=O)o2)cc1 |
| InChI | InChI=1S/C19H23N3O5S/c1-3-13-26-15-9-6-14(7-10-15)8-11-17(23)22-12-4-5-16(22)18-20-21-19(27-18)28(2,24)25/h6-11,16H,3-5,12-13H2,1-2H3/b11-8+/t16-/m0/s1 |
| InChIKey | DZEQMYUJDCMSKR-KXKDPZRNSA-N |
| XLogP | 2.64 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|