C13H23ClN4O3 — CID 119380481
1-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-4-ethylpiperazine-2,3-dione;hydrochloride (PubChem CID 119380481) has the molecular formula C13H23ClN4O3 and a molecular weight of 318.81 g/mol. Its IUPAC name is 1-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-4-ethylpiperazine-2,3-dione;hydrochloride.
| Compound Name | 1-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-4-ethylpiperazine-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119380481 |
| Molecular Formula | C13H23ClN4O3 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-[2-(3-aminopiperidin-1-yl)-2-oxoethyl]-4-ethylpiperazine-2,3-dione;hydrochloride |
| SMILES | CCN1CCN(CC(=O)N2CCCC(N)C2)C(=O)C1=O.Cl |
| InChI | InChI=1S/C13H22N4O3.ClH/c1-2-15-6-7-17(13(20)12(15)19)9-11(18)16-5-3-4-10(14)8-16;/h10H,2-9,14H2,1H3;1H |
| InChIKey | YTDZOOWMJMUBHD-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|