C10H15ClN2OS — CID 119383881
N-(2-aminoethyl)-3-cyclopropylthiophene-2-carboxamide;hydrochloride (PubChem CID 119383881) has the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-cyclopropylthiophene-2-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-3-cyclopropylthiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119383881 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-(2-aminoethyl)-3-cyclopropylthiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)c1sccc1C1CC1 |
| InChI | InChI=1S/C10H14N2OS.ClH/c11-4-5-12-10(13)9-8(3-6-14-9)7-1-2-7;/h3,6-7H,1-2,4-5,11H2,(H,12,13);1H |
| InChIKey | FQXAHHXMEZROLM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |