C15H18BrClN2O2S — CID 119384657
N-(2-aminoethyl)-3-[(5-bromothiophen-3-yl)methoxy]-4-methylbenzamide;hydrochloride (PubChem CID 119384657) has the molecular formula C15H18BrClN2O2S and a molecular weight of 405.75 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-[(5-bromothiophen-3-yl)methoxy]-4-methylbenzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-3-[(5-bromothiophen-3-yl)methoxy]-4-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119384657 |
| Molecular Formula | C15H18BrClN2O2S |
| Molecular Weight | 405.75 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | N-(2-aminoethyl)-3-[(5-bromothiophen-3-yl)methoxy]-4-methylbenzamide;hydrochloride |
| SMILES | Cc1ccc(C(=O)NCCN)cc1OCc1csc(Br)c1.Cl |
| InChI | InChI=1S/C15H17BrN2O2S.ClH/c1-10-2-3-12(15(19)18-5-4-17)7-13(10)20-8-11-6-14(16)21-9-11;/h2-3,6-7,9H,4-5,8,17H2,1H3,(H,18,19);1H |
| InChIKey | XGARPHZPVTXJOA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |