C16H28N3O3+ — CID 11938519
[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl-[2-(tert-butylamino)-2-oxoethyl]-methylazanium (PubChem CID 11938519) has the molecular formula C16H28N3O3+ and a molecular weight of 310.42 g/mol. Its IUPAC name is [(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl-[2-(tert-butylamino)-2-oxoethyl]-methylazanium.
| Compound Name | [(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl-[2-(tert-butylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 11938519 |
| Molecular Formula | C16H28N3O3+ |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | [(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl-[2-(tert-butylamino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)NC(C)(C)C)CN1C(=O)[C@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C16H27N3O3/c1-16(2,3)17-13(20)9-18(4)10-19-14(21)11-7-5-6-8-12(11)15(19)22/h11-12H,5-10H2,1-4H3,(H,17,20)/p+1/t11-,12-/m0/s1 |
| InChIKey | ZKIMPYSSBQJMHJ-RYUDHWBXSA-O |
| XLogP | -0.45 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|