C18H26ClN3O2S — CID 119392997
5-methoxy-3-methyl-N-(3-piperazin-1-ylpropyl)-1-benzothiophene-2-carboxamide;hydrochloride (PubChem CID 119392997) has the molecular formula C18H26ClN3O2S and a molecular weight of 383.95 g/mol. Its IUPAC name is 5-methoxy-3-methyl-N-(3-piperazin-1-ylpropyl)-1-benzothiophene-2-carboxamide;hydrochloride.
| Compound Name | 5-methoxy-3-methyl-N-(3-piperazin-1-ylpropyl)-1-benzothiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119392997 |
| Molecular Formula | C18H26ClN3O2S |
| Molecular Weight | 383.95 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 5-methoxy-3-methyl-N-(3-piperazin-1-ylpropyl)-1-benzothiophene-2-carboxamide;hydrochloride |
| SMILES | COc1ccc2sc(C(=O)NCCCN3CCNCC3)c(C)c2c1.Cl |
| InChI | InChI=1S/C18H25N3O2S.ClH/c1-13-15-12-14(23-2)4-5-16(15)24-17(13)18(22)20-6-3-9-21-10-7-19-8-11-21;/h4-5,12,19H,3,6-11H2,1-2H3,(H,20,22);1H |
| InChIKey | AVKJMDNCULPGOV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.95 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|