C12H16F3N3O2 — CID 119399157
(2S)-2-amino-4-methyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]pentanamide (PubChem CID 119399157) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]pentanamide |
|---|---|
| PubChem CID | 119399157 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C12H16F3N3O2/c1-6(2)3-8(16)10(19)18-9-4-7(12(13,14)15)5-17-11(9)20/h4-6,8H,3,16H2,1-2H3,(H,17,20)(H,18,19)/t8-/m0/s1 |
| InChIKey | CRBYZXBYQYOVCU-QMMMGPOBSA-N |
| XLogP | 1.71 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |