C12H14F3N3O2 — CID 72046368
N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-3-carboxamide (PubChem CID 72046368) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.25 g/mol. Its IUPAC name is N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-3-carboxamide.
| Compound Name | N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 72046368 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-3-carboxamide |
| SMILES | C1CC(CNC1)C(=O)NC2=CC(=CNC2=O)C(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O2/c13-12(14,15)8-4-9(11(20)17-6-8)18-10(19)7-2-1-3-16-5-7/h4,6-7,16H,1-3,5H2,(H,17,20)(H,18,19) |
| InChIKey | YCMACBCUBBRCKK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 70.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | 483 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |