C20H30N3O2S+ — CID 11940916
2-[[2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 11940916) has the molecular formula C20H30N3O2S+ and a molecular weight of 376.55 g/mol. Its IUPAC name is 2-[[2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 11940916 |
| Molecular Formula | C20H30N3O2S+ |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 2-[[2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)C[NH+]2CC[C@H]3CCCC[C@@H]3C2)sc2c1CCCC2 |
| InChI | InChI=1S/C20H29N3O2S/c21-19(25)18-15-7-3-4-8-16(15)26-20(18)22-17(24)12-23-10-9-13-5-1-2-6-14(13)11-23/h13-14H,1-12H2,(H2,21,25)(H,22,24)/p+1/t13-,14-/m1/s1 |
| InChIKey | PHISCDCSDGZPOT-ZIAGYGMSSA-O |
| XLogP | 1.76 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |