C19H27N3O2S — CID 41135562
2-[[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 41135562) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is 2-[[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 41135562 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-[[2-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]acetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)CN2CCC[C@H]3CCCC[C@H]32)sc2c1CCC2 |
| InChI | InChI=1S/C19H27N3O2S/c20-18(24)17-13-7-3-9-15(13)25-19(17)21-16(23)11-22-10-4-6-12-5-1-2-8-14(12)22/h12,14H,1-11H2,(H2,20,24)(H,21,23)/t12-,14-/m1/s1 |
| InChIKey | WDPYWDBMFICEGM-TZMCWYRMSA-N |
| XLogP | 2.93 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |