C20H25N3O3S — CID 11941075
(3S)-N-[(Z)-[(1S,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 11941075) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is (3S)-N-[(Z)-[(1S,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[(Z)-[(1S,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 11941075 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (3S)-N-[(Z)-[(1S,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)N/N=C3/C[C@H]4C=CC[C@H]34)C2)cc1 |
| InChI | InChI=1S/C20H25N3O3S/c1-14-7-9-17(10-8-14)27(25,26)23-11-3-5-16(13-23)20(24)22-21-19-12-15-4-2-6-18(15)19/h2,4,7-10,15-16,18H,3,5-6,11-13H2,1H3,(H,22,24)/b21-19-/t15-,16+,18+/m1/s1 |
| InChIKey | SMLJSQWNGCQHCM-MEGKHKLASA-N |
| XLogP | 2.46 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|