C16H23N3O3S — CID 119419740
N-(3-amino-4-methoxyphenyl)-3-(2,2-dimethylpropanoyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 119419740) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-3-(2,2-dimethylpropanoyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-3-(2,2-dimethylpropanoyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 119419740 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-3-(2,2-dimethylpropanoyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CSCN2C(=O)C(C)(C)C)cc1N |
| InChI | InChI=1S/C16H23N3O3S/c1-16(2,3)15(21)19-9-23-8-12(19)14(20)18-10-5-6-13(22-4)11(17)7-10/h5-7,12H,8-9,17H2,1-4H3,(H,18,20) |
| InChIKey | ZSODQINRUTVQJX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|