C11H18BrClN2O2S — CID 119434344
4-bromo-3-methoxy-5-methyl-N-[3-(methylamino)propyl]thiophene-2-carboxamide;hydrochloride (PubChem CID 119434344) has the molecular formula C11H18BrClN2O2S and a molecular weight of 357.70 g/mol. Its IUPAC name is 4-bromo-3-methoxy-5-methyl-N-[3-(methylamino)propyl]thiophene-2-carboxamide;hydrochloride.
| Compound Name | 4-bromo-3-methoxy-5-methyl-N-[3-(methylamino)propyl]thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119434344 |
| Molecular Formula | C11H18BrClN2O2S |
| Molecular Weight | 357.70 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 4-bromo-3-methoxy-5-methyl-N-[3-(methylamino)propyl]thiophene-2-carboxamide;hydrochloride |
| SMILES | CNCCCNC(=O)c1sc(C)c(Br)c1OC.Cl |
| InChI | InChI=1S/C11H17BrN2O2S.ClH/c1-7-8(12)9(16-3)10(17-7)11(15)14-6-4-5-13-2;/h13H,4-6H2,1-3H3,(H,14,15);1H |
| InChIKey | BAPNBAQGNPEOOJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.70 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|