C7H8BrNO3S — CID 130778418
4-bromo-N-hydroxy-3-methoxy-5-methylthiophene-2-carboxamide (PubChem CID 130778418) has the molecular formula C7H8BrNO3S and a molecular weight of 266.12 g/mol. Its IUPAC name is 4-bromo-N-hydroxy-3-methoxy-5-methylthiophene-2-carboxamide.
| Compound Name | 4-bromo-N-hydroxy-3-methoxy-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 130778418 |
| Molecular Formula | C7H8BrNO3S |
| Molecular Weight | 266.12 g/mol |
| Exact Mass | 264.94 |
| IUPAC Name | 4-bromo-N-hydroxy-3-methoxy-5-methylthiophene-2-carboxamide |
| SMILES | COc1c(C(=O)NO)sc(C)c1Br |
| InChI | InChI=1S/C7H8BrNO3S/c1-3-4(8)5(12-2)6(13-3)7(10)9-11/h11H,1-2H3,(H,9,10) |
| InChIKey | DWAIYYOLWOUCDL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|