C20H30N4O2S2 — CID 11945937
2-[2-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(3-methylphenyl)acetamide (PubChem CID 11945937) has the molecular formula C20H30N4O2S2 and a molecular weight of 422.62 g/mol. Its IUPAC name is 2-[2-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 11945937 |
| Molecular Formula | C20H30N4O2S2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[2-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-2-oxoethyl]sulfanyl-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CSCC(=O)NNC(=S)N[C@H]2CCC[C@@H](C)[C@@H]2C)c1 |
| InChI | InChI=1S/C20H30N4O2S2/c1-13-6-4-8-16(10-13)21-18(25)11-28-12-19(26)23-24-20(27)22-17-9-5-7-14(2)15(17)3/h4,6,8,10,14-15,17H,5,7,9,11-12H2,1-3H3,(H,21,25)(H,23,26)(H2,22,24,27)/t14-,15+,17+/m1/s1 |
| InChIKey | QKMJBVSJXMGHJE-VYDXJSESSA-N |
| XLogP | 2.99 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|