C14H18Cl4N2O2 — CID 119468976
1-[2-(aminomethyl)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride (PubChem CID 119468976) has the molecular formula C14H18Cl4N2O2 and a molecular weight of 388.12 g/mol. Its IUPAC name is 1-[2-(aminomethyl)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride.
| Compound Name | 1-[2-(aminomethyl)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119468976 |
| Molecular Formula | C14H18Cl4N2O2 |
| Molecular Weight | 388.12 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 1-[2-(aminomethyl)piperidin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone;hydrochloride |
| SMILES | Cl.NCC1CCCCN1C(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl3N2O2.ClH/c15-10-5-12(17)13(6-11(10)16)21-8-14(20)19-4-2-1-3-9(19)7-18;/h5-6,9H,1-4,7-8,18H2;1H |
| InChIKey | ZYNXKIQSBIXJQW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.12 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|