C17H22Cl3N3O2 — CID 70863784
1-[(2R)-2-(pyrrolidin-1-ylmethyl)piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone (PubChem CID 70863784) has the molecular formula C17H22Cl3N3O2 and a molecular weight of 406.74 g/mol. Its IUPAC name is 1-[(2R)-2-(pyrrolidin-1-ylmethyl)piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone.
| Compound Name | 1-[(2R)-2-(pyrrolidin-1-ylmethyl)piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 70863784 |
| Molecular Formula | C17H22Cl3N3O2 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 1-[(2R)-2-(pyrrolidin-1-ylmethyl)piperazin-1-yl]-2-(2,4,5-trichlorophenoxy)ethanone |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCNC[C@@H]1CN1CCCC1 |
| InChI | InChI=1S/C17H22Cl3N3O2/c18-13-7-15(20)16(8-14(13)19)25-11-17(24)23-6-3-21-9-12(23)10-22-4-1-2-5-22/h7-8,12,21H,1-6,9-11H2/t12-/m1/s1 |
| InChIKey | ADRWNHFFLQEYTJ-GFCCVEGCSA-N |
| XLogP | 2.92 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|