C35H37ClN2O3 — CID 11946955
(3aR,7aS)-2-[(2S)-1-[(4R)-4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-1-oxo-3-phenylpropan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 11946955) has the molecular formula C35H37ClN2O3 and a molecular weight of 569.15 g/mol. Its IUPAC name is (3aR,7aS)-2-[(2S)-1-[(4R)-4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-1-oxo-3-phenylpropan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-2-[(2S)-1-[(4R)-4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-1-oxo-3-phenylpropan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11946955 |
| Molecular Formula | C35H37ClN2O3 |
| Molecular Weight | 569.15 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | (3aR,7aS)-2-[(2S)-1-[(4R)-4-(4-chlorophenyl)-2,2,4-trimethyl-3H-quinolin-1-yl]-1-oxo-3-phenylpropan-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC1(C)C[C@](C)(c2ccc(Cl)cc2)c2ccccc2N1C(=O)[C@H](Cc1ccccc1)N1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C35H37ClN2O3/c1-34(2)22-35(3,24-17-19-25(36)20-18-24)28-15-9-10-16-29(28)38(34)33(41)30(21-23-11-5-4-6-12-23)37-31(39)26-13-7-8-14-27(26)32(37)40/h4-6,9-12,15-20,26-27,30H,7-8,13-14,21-22H2,1-3H3/t26-,27+,30-,35+/m0/s1 |
| InChIKey | QXPZFQNCJITZFC-LUIOGSOVSA-N |
| XLogP | 6.95 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.15 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|