C17H25ClN4O4S — CID 119476514
N-(4-aminocyclohexyl)-4-(3-oxopiperazin-1-yl)sulfonylbenzamide;hydrochloride (PubChem CID 119476514) has the molecular formula C17H25ClN4O4S and a molecular weight of 416.93 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-(3-oxopiperazin-1-yl)sulfonylbenzamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-4-(3-oxopiperazin-1-yl)sulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119476514 |
| Molecular Formula | C17H25ClN4O4S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-(3-oxopiperazin-1-yl)sulfonylbenzamide;hydrochloride |
| SMILES | Cl.NC1CCC(NC(=O)c2ccc(S(=O)(=O)N3CCNC(=O)C3)cc2)CC1 |
| InChI | InChI=1S/C17H24N4O4S.ClH/c18-13-3-5-14(6-4-13)20-17(23)12-1-7-15(8-2-12)26(24,25)21-10-9-19-16(22)11-21;/h1-2,7-8,13-14H,3-6,9-11,18H2,(H,19,22)(H,20,23);1H |
| InChIKey | PGIJEBPPDRNZLK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |