C16H20F2N2O2 — CID 119478251
N-(4-aminocyclohexyl)-4-(2,4-difluorophenyl)-4-oxobutanamide (PubChem CID 119478251) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-(2,4-difluorophenyl)-4-oxobutanamide.
| Compound Name | N-(4-aminocyclohexyl)-4-(2,4-difluorophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 119478251 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-(2,4-difluorophenyl)-4-oxobutanamide |
| SMILES | NC1CCC(NC(=O)CCC(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C16H20F2N2O2/c17-10-1-6-13(14(18)9-10)15(21)7-8-16(22)20-12-4-2-11(19)3-5-12/h1,6,9,11-12H,2-5,7-8,19H2,(H,20,22) |
| InChIKey | YBVCVQHXTJTSDL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |