C21H28F2N2O2 — CID 162657821
N-(1-cyclohexylpiperidin-4-yl)-4-(2,4-difluorophenyl)-4-oxobutanamide (PubChem CID 162657821) has the molecular formula C21H28F2N2O2 and a molecular weight of 378.46 g/mol. Its IUPAC name is N-(1-cyclohexylpiperidin-4-yl)-4-(2,4-difluorophenyl)-4-oxobutanamide.
| Compound Name | N-(1-cyclohexylpiperidin-4-yl)-4-(2,4-difluorophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 162657821 |
| Molecular Formula | C21H28F2N2O2 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-(1-cyclohexylpiperidin-4-yl)-4-(2,4-difluorophenyl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(F)cc1F)NC1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H28F2N2O2/c22-15-6-7-18(19(23)14-15)20(26)8-9-21(27)24-16-10-12-25(13-11-16)17-4-2-1-3-5-17/h6-7,14,16-17H,1-5,8-13H2,(H,24,27) |
| InChIKey | YQDOWOXIAXSJEB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |