C16H19BrClN3O2 — CID 119493998
8-bromo-4-[3-(methylamino)piperidine-1-carbonyl]-1H-quinolin-2-one;hydrochloride (PubChem CID 119493998) has the molecular formula C16H19BrClN3O2 and a molecular weight of 400.70 g/mol. Its IUPAC name is 8-bromo-4-[3-(methylamino)piperidine-1-carbonyl]-1H-quinolin-2-one;hydrochloride.
| Compound Name | 8-bromo-4-[3-(methylamino)piperidine-1-carbonyl]-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119493998 |
| Molecular Formula | C16H19BrClN3O2 |
| Molecular Weight | 400.70 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 8-bromo-4-[3-(methylamino)piperidine-1-carbonyl]-1H-quinolin-2-one;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2cc(=O)[nH]c3c(Br)cccc23)C1.Cl |
| InChI | InChI=1S/C16H18BrN3O2.ClH/c1-18-10-4-3-7-20(9-10)16(22)12-8-14(21)19-15-11(12)5-2-6-13(15)17;/h2,5-6,8,10,18H,3-4,7,9H2,1H3,(H,19,21);1H |
| InChIKey | DEDPCZLYRSVXBP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.70 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |