C16H18BrN3O2 — CID 124587988
8-bromo-4-[(3S)-3-(methylamino)piperidine-1-carbonyl]-1H-quinolin-2-one (PubChem CID 124587988) has the molecular formula C16H18BrN3O2 and a molecular weight of 364.24 g/mol. Its IUPAC name is 8-bromo-4-[(3S)-3-(methylamino)piperidine-1-carbonyl]-1H-quinolin-2-one.
| Compound Name | 8-bromo-4-[(3S)-3-(methylamino)piperidine-1-carbonyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 124587988 |
| Molecular Formula | C16H18BrN3O2 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 8-bromo-4-[(3S)-3-(methylamino)piperidine-1-carbonyl]-1H-quinolin-2-one |
| SMILES | CN[C@H]1CCCN(C(=O)c2cc(=O)[nH]c3c(Br)cccc23)C1 |
| InChI | InChI=1S/C16H18BrN3O2/c1-18-10-4-3-7-20(9-10)16(22)12-8-14(21)19-15-11(12)5-2-6-13(15)17/h2,5-6,8,10,18H,3-4,7,9H2,1H3,(H,19,21)/t10-/m0/s1 |
| InChIKey | QNGQEVHKQJXQBK-JTQLQIEISA-N |
| XLogP | 2.11 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |