C13H25ClN4O3 — CID 119498732
N-(3-aminobutyl)-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanamide;hydrochloride (PubChem CID 119498732) has the molecular formula C13H25ClN4O3 and a molecular weight of 320.82 g/mol. Its IUPAC name is N-(3-aminobutyl)-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119498732 |
| Molecular Formula | C13H25ClN4O3 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | N-(3-aminobutyl)-4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)butanamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)CCCN1C(=O)NC(C)(C)C1=O.Cl |
| InChI | InChI=1S/C13H24N4O3.ClH/c1-9(14)6-7-15-10(18)5-4-8-17-11(19)13(2,3)16-12(17)20;/h9H,4-8,14H2,1-3H3,(H,15,18)(H,16,20);1H |
| InChIKey | YCQKZJDCCBDMGI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|