C19H27N3O6 — CID 24515994
4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide (PubChem CID 24515994) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide.
| Compound Name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 24515994 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]butanamide |
| SMILES | COc1cc(CNC(=O)CCCN2C(=O)NC(C)(C)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C19H27N3O6/c1-19(2)17(24)22(18(25)21-19)8-6-7-15(23)20-11-12-9-13(26-3)16(28-5)14(10-12)27-4/h9-10H,6-8,11H2,1-5H3,(H,20,23)(H,21,25) |
| InChIKey | WDMHAVJFVHENBA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|