C32H57NO8 — CID 11949941
[(2R,3R,4R,5S)-3,4,5-tri(butanoyloxy)-1-(8-methylnonyl)piperidin-2-yl]methyl butanoate (PubChem CID 11949941) has the molecular formula C32H57NO8 and a molecular weight of 583.81 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4,5-tri(butanoyloxy)-1-(8-methylnonyl)piperidin-2-yl]methyl butanoate.
| Compound Name | [(2R,3R,4R,5S)-3,4,5-tri(butanoyloxy)-1-(8-methylnonyl)piperidin-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 11949941 |
| Molecular Formula | C32H57NO8 |
| Molecular Weight | 583.81 g/mol |
| Exact Mass | 583.41 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-tri(butanoyloxy)-1-(8-methylnonyl)piperidin-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@@H]1[C@@H](OC(=O)CCC)[C@H](OC(=O)CCC)[C@@H](OC(=O)CCC)CN1CCCCCCCC(C)C |
| InChI | InChI=1S/C32H57NO8/c1-7-16-27(34)38-23-25-31(40-29(36)18-9-3)32(41-30(37)19-10-4)26(39-28(35)17-8-2)22-33(25)21-15-13-11-12-14-20-24(5)6/h24-26,31-32H,7-23H2,1-6H3/t25-,26+,31-,32-/m1/s1 |
| InChIKey | JECGKSGOFCJLGL-CRJTYWNXSA-N |
| XLogP | 6.15 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.81 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|