C30H53NO8 — CID 11952074
[(2R,3R,4R,5S)-3,4,5-tri(butanoyloxy)-1-octylpiperidin-2-yl]methyl butanoate (PubChem CID 11952074) has the molecular formula C30H53NO8 and a molecular weight of 555.75 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4,5-tri(butanoyloxy)-1-octylpiperidin-2-yl]methyl butanoate.
| Compound Name | [(2R,3R,4R,5S)-3,4,5-tri(butanoyloxy)-1-octylpiperidin-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 11952074 |
| Molecular Formula | C30H53NO8 |
| Molecular Weight | 555.75 g/mol |
| Exact Mass | 555.38 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-tri(butanoyloxy)-1-octylpiperidin-2-yl]methyl butanoate |
| SMILES | CCCCCCCCN1C[C@H](OC(=O)CCC)[C@@H](OC(=O)CCC)[C@H](OC(=O)CCC)[C@H]1COC(=O)CCC |
| InChI | InChI=1S/C30H53NO8/c1-6-11-12-13-14-15-20-31-21-24(37-26(33)17-8-3)30(39-28(35)19-10-5)29(38-27(34)18-9-4)23(31)22-36-25(32)16-7-2/h23-24,29-30H,6-22H2,1-5H3/t23-,24+,29-,30-/m1/s1 |
| InChIKey | HIDXMKRQMCJVNH-XSHKJCDBSA-N |
| XLogP | 5.51 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.75 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|