C22H37NO8 — CID 139833602
[(2R,3R,4R,5S)-3,4,5-tri(butanoyloxy)-1-deuteriopiperidin-2-yl]methyl butanoate (PubChem CID 139833602) has the molecular formula C22H37NO8 and a molecular weight of 444.54 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4,5-tri(butanoyloxy)-1-deuteriopiperidin-2-yl]methyl butanoate.
| Compound Name | [(2R,3R,4R,5S)-3,4,5-tri(butanoyloxy)-1-deuteriopiperidin-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 139833602 |
| Molecular Formula | C22H37NO8 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-tri(butanoyloxy)-1-deuteriopiperidin-2-yl]methyl butanoate |
| SMILES | [2H]N1CC(OC(=O)CCC)[C@@H](OC(=O)CCC)[C@H](OC(=O)CCC)[C@H]1COC(=O)CCC |
| InChI | InChI=1S/C22H37NO8/c1-5-9-17(24)28-14-15-21(30-19(26)11-7-3)22(31-20(27)12-8-4)16(13-23-15)29-18(25)10-6-2/h15-16,21-23H,5-14H2,1-4H3/t15-,16?,21-,22-/m1/s1/i/hD |
| InChIKey | VBSOCEQLKVTLDP-MYHLGCKESA-N |
| XLogP | 2.44 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|