C17H26ClN3O4S — CID 119502993
1-(4-acetylphenyl)sulfonyl-N-[2-(methylamino)ethyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119502993) has the molecular formula C17H26ClN3O4S and a molecular weight of 403.93 g/mol. Its IUPAC name is 1-(4-acetylphenyl)sulfonyl-N-[2-(methylamino)ethyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | 1-(4-acetylphenyl)sulfonyl-N-[2-(methylamino)ethyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119502993 |
| Molecular Formula | C17H26ClN3O4S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-(4-acetylphenyl)sulfonyl-N-[2-(methylamino)ethyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)C1CCCCN1S(=O)(=O)c1ccc(C(C)=O)cc1.Cl |
| InChI | InChI=1S/C17H25N3O4S.ClH/c1-13(21)14-6-8-15(9-7-14)25(23,24)20-12-4-3-5-16(20)17(22)19-11-10-18-2;/h6-9,16,18H,3-5,10-12H2,1-2H3,(H,19,22);1H |
| InChIKey | FFJOHHUOFBJQMA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|